
CAS 1385696-40-1
:2H-Pyran-4-amine, 4-[(2-bromophenyl)methyl]tetrahydro-, hydrochloride (1:1)
Description:
2H-Pyran-4-amine, 4-[(2-bromophenyl)methyl]tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a pyran ring and an amine functional group. The presence of the bromophenyl group indicates that it has significant aromatic characteristics, which can influence its reactivity and interaction with biological systems. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential applications in pharmaceutical formulations. The compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential for hydrogen bonding and other intermolecular interactions, which can affect its pharmacokinetics and pharmacodynamics. Additionally, the presence of halogen atoms, such as bromine, can enhance lipophilicity and influence the compound's behavior in biological systems. Overall, this compound's unique features make it a subject of interest for further research in drug development and related fields.
Formula:C12H16BrNO·ClH
InChI:InChI=1S/C12H16BrNO.ClH/c13-11-4-2-1-3-10(11)9-12(14)5-7-15-8-6-12;/h1-4H,5-9,14H2;1H
InChI key:InChIKey=QLKZGOUEUFPXQU-UHFFFAOYSA-N
SMILES:C(C1(N)CCOCC1)C2=C(Br)C=CC=C2.Cl
Synonyms:- 2H-Pyran-4-amine, 4-[(2-bromophenyl)methyl]tetrahydro-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
