CAS 1385696-44-5
:Ethyl 5-(2-fluorophenyl)-1,2,4-oxadiazole-3-carboxylate
Description:
Ethyl 5-(2-fluorophenyl)-1,2,4-oxadiazole-3-carboxylate is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. The presence of a 2-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, which can influence the compound's electronic properties and reactivity. This compound features an ethyl ester functional group, contributing to its solubility and potential applications in organic synthesis. The oxadiazole moiety is known for its biological activity, making such compounds of interest in medicinal chemistry and drug development. The specific arrangement of functional groups in this molecule can affect its pharmacokinetics and pharmacodynamics, making it a candidate for further research in various fields, including agrochemicals and pharmaceuticals. Additionally, the compound's stability, melting point, and solubility characteristics would be essential for practical applications, although these specific properties would need to be determined experimentally.
Formula:C11H9FN2O3
InChI:InChI=1S/C11H9FN2O3/c1-2-16-11(15)9-13-10(17-14-9)7-5-3-4-6-8(7)12/h3-6H,2H2,1H3
InChI key:InChIKey=LPQOKOGQUZVKIZ-UHFFFAOYSA-N
SMILES:FC1=C(C2=NC(C(OCC)=O)=NO2)C=CC=C1
Synonyms:- Ethyl 5-(2-fluorophenyl)-1,2,4-oxadiazole-3-carboxylate
- 1,2,4-Oxadiazole-3-carboxylic acid, 5-(2-fluorophenyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethyl 5-(2-fluorophenyl)-1,2,4-oxadiazole-3-carboxylate
CAS:Formula:C11H9FN2O3Molecular weight:236.202
