CAS 1385696-46-7
:4-(Cyclobutylmethyl)tetrahydro-2H-pyran-4-methanamine
Description:
4-(Cyclobutylmethyl)tetrahydro-2H-pyran-4-methanamine is a chemical compound characterized by its unique structure, which includes a tetrahydro-pyran ring fused with a cyclobutylmethyl group and a methanamine functional group. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the tetrahydropyran ring suggests potential for conformational flexibility, which may affect its interaction with biological targets if it is intended for pharmaceutical applications. Additionally, the cyclobutyl group can introduce steric effects that may influence the compound's overall stability and reactivity. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the molecular interactions and the environment in which the compound is studied. Overall, this compound's structural features suggest it may have interesting chemical and biological properties worthy of further investigation.
Formula:C11H21NO
InChI:InChI=1S/C11H21NO/c12-9-11(4-6-13-7-5-11)8-10-2-1-3-10/h10H,1-9,12H2
InChI key:InChIKey=BMFJSLWKIYECAB-UHFFFAOYSA-N
SMILES:C(C1(CN)CCOCC1)C2CCC2
Synonyms:- 2H-Pyran-4-methanamine, 4-(cyclobutylmethyl)tetrahydro-
- 4-(Cyclobutylmethyl)tetrahydro-2H-pyran-4-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
