CAS 1385696-53-6
:4-(Cyclobutylmethoxy)-2-pyridinecarboxylic acid
Description:
4-(Cyclobutylmethoxy)-2-pyridinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a carboxylic acid group and a cyclobutylmethoxy group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of the pyridine and cyclobutane moieties. It is likely to be a solid at room temperature, with moderate solubility in polar solvents, reflecting the influence of the carboxylic acid functionality. The presence of the methoxy group can enhance its lipophilicity, potentially affecting its biological activity and interaction with other molecules. As a pyridine derivative, it may exhibit basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Its specific applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and reactivity. Overall, this compound represents a fascinating example of how structural modifications can influence the chemical behavior and potential applications of organic molecules.
Formula:C11H13NO3
InChI:InChI=1S/C11H13NO3/c13-11(14)10-6-9(4-5-12-10)15-7-8-2-1-3-8/h4-6,8H,1-3,7H2,(H,13,14)
InChI key:InChIKey=WHCJROVYQBRWKC-UHFFFAOYSA-N
SMILES:O(CC1CCC1)C=2C=C(C(O)=O)N=CC2
Synonyms:- 4-(Cyclobutylmethoxy)-2-pyridinecarboxylic acid
- 2-Pyridinecarboxylic acid, 4-(cyclobutylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
