
CAS 1385696-55-8
:2H-Pyran-4-methanamine, tetrahydro-4-(phenylmethyl)-, hydrochloride (1:1)
Description:
2H-Pyran-4-methanamine, tetrahydro-4-(phenylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a pyran ring and an amine functional group. The presence of the tetrahydro configuration indicates that the compound is saturated, contributing to its stability and solubility in polar solvents. The phenylmethyl group enhances its lipophilicity, potentially influencing its biological activity and interaction with various receptors. As a hydrochloride salt, it is typically more soluble in water than its free base form, which is advantageous for pharmaceutical applications. This compound may exhibit properties relevant to medicinal chemistry, including potential use in drug development or as a research tool in biochemical studies. Its specific interactions and effects would depend on its molecular conformation and the presence of functional groups, making it a subject of interest for further investigation in both synthetic and medicinal chemistry contexts.
Formula:C13H19NO·ClH
InChI:InChI=1S/C13H19NO.ClH/c14-11-13(6-8-15-9-7-13)10-12-4-2-1-3-5-12;/h1-5H,6-11,14H2;1H
InChI key:InChIKey=WLTSMMGQCXCHBY-UHFFFAOYSA-N
SMILES:C(C1(CN)CCOCC1)C2=CC=CC=C2.Cl
Synonyms:- 2H-Pyran-4-methanamine, tetrahydro-4-(phenylmethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
