CAS 1385696-60-5

Piperidine, 4-[5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic amine. The presence of the 1,2,4-oxadiazole moiety introduces unique properties, including potential biological activity, due to its nitrogen-containing structure. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacological properties. The 2-methylpropyl substituent contributes to the compound's lipophilicity, potentially affecting its permeability and interaction with biological membranes. As with many piperidine derivatives, this compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Safety and handling precautions are essential, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties, including its stability, reactivity, and specific applications in research or industry.

Formula: C₁₁H₁₉N₃O·ClH

InChI: InChI=1S/C11H19N3O.ClH/c1-8(2)7-10-13-11(14-15-10)9-3-5-12-6-4-9;/h8-9,12H,3-7H2,1-2H3;1H

InChI key: InChIKey=KERDHQWRFWPCBR-UHFFFAOYSA-N

SMILES: C(C(C)C)C1=NC(=NO1)C2CCNCC2.Cl

Synonyms:

• Piperidine, 4-[5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1)

4-[5-(2-Methylpropyl)-1,2,4-oxadiazol-3-yl]piperidine hydrochloride

CAS: 1385696-60-5

Formula: C₁₁H₂₀ClN₃O

Molecular weight: 245.75

Ref: 10-F097280