CymitQuimica logo

CAS 1385696-67-2

:

5-(3-Oxetanyloxy)-3-pyridinecarboxylic acid

Description:
5-(3-Oxetanyloxy)-3-pyridinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyridine ring and an oxetane moiety. The presence of the pyridine ring contributes to its aromatic properties, while the carboxylic acid functional group imparts acidic characteristics, making it potentially useful in various chemical reactions and applications. The oxetane group, a four-membered cyclic ether, adds to the compound's reactivity and may influence its solubility and stability. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular interactions could be significant in drug design, particularly in targeting specific biological pathways. The compound's properties, such as melting point, boiling point, solubility, and reactivity, would depend on its molecular structure and the functional groups present. Overall, 5-(3-Oxetanyloxy)-3-pyridinecarboxylic acid represents a versatile structure that could be explored for various synthetic and medicinal chemistry applications.
Formula:C9H9NO4
InChI:InChI=1S/C9H9NO4/c11-9(12)6-1-7(3-10-2-6)14-8-4-13-5-8/h1-3,8H,4-5H2,(H,11,12)
InChI key:InChIKey=DOMTVKLWSCSYBR-UHFFFAOYSA-N
SMILES:O(C=1C=C(C(O)=O)C=NC1)C2COC2
Synonyms:
  • 3-Pyridinecarboxylic acid, 5-(3-oxetanyloxy)-
  • 5-(3-Oxetanyloxy)-3-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.