CAS 1385696-69-4
:Methyl tetrahydro-4-(4-pyridinyl)-2H-pyran-4-carboxylate
Description:
Methyl tetrahydro-4-(4-pyridinyl)-2H-pyran-4-carboxylate, identified by its CAS number 1385696-69-4, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a tetrahydropyran moiety. This compound typically exhibits properties associated with both heterocyclic and carboxylate functionalities, making it of interest in various chemical and pharmaceutical applications. The presence of the pyridine ring suggests potential for interactions with biological systems, possibly influencing its solubility and reactivity. Additionally, the ester functional group contributes to its chemical behavior, allowing for potential hydrolysis or transesterification reactions. Methyl tetrahydro-4-(4-pyridinyl)-2H-pyran-4-carboxylate may also display specific optical properties due to its chiral centers, which could be relevant in the context of drug design and synthesis. Overall, this compound's structural complexity and functional groups position it as a candidate for further research in medicinal chemistry and related fields.
Formula:C12H15NO3
InChI:InChI=1S/C12H15NO3/c1-15-11(14)12(4-8-16-9-5-12)10-2-6-13-7-3-10/h2-3,6-7H,4-5,8-9H2,1H3
InChI key:InChIKey=XHOUAILUEPKRFH-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1(CCOCC1)C=2C=CN=CC2
Synonyms:- Methyl tetrahydro-4-(4-pyridinyl)-2H-pyran-4-carboxylate
- 2H-Pyran-4-carboxylic acid, tetrahydro-4-(4-pyridinyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
