CAS 1385696-72-9
:Tetrahydro-4-[2-(trifluoromethyl)phenyl]-2H-pyran-4-carboxylic acid
Description:
Tetrahydro-4-[2-(trifluoromethyl)phenyl]-2H-pyran-4-carboxylic acid is a chemical compound characterized by its unique structure, which includes a tetrahydropyran ring and a trifluoromethyl-substituted phenyl group. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and biological activity. The tetrahydropyran moiety provides a cyclic structure that may contribute to conformational rigidity, potentially affecting the compound's interactions with biological targets. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which can be tailored for specific pharmacological activities. Additionally, the trifluoromethyl group is known to impart unique electronic properties, making such compounds valuable in various chemical applications, including agrochemicals and pharmaceuticals. Overall, the characteristics of this compound suggest potential utility in research and development within the fields of organic and medicinal chemistry.
Formula:C13H13F3O3
InChI:InChI=1S/C13H13F3O3/c14-13(15,16)10-4-2-1-3-9(10)12(11(17)18)5-7-19-8-6-12/h1-4H,5-8H2,(H,17,18)
InChI key:InChIKey=IPWGGABVGDKEES-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(CCOCC1)C2=C(C(F)(F)F)C=CC=C2
Synonyms:- 2H-Pyran-4-carboxylic acid, tetrahydro-4-[2-(trifluoromethyl)phenyl]-
- Tetrahydro-4-[2-(trifluoromethyl)phenyl]-2H-pyran-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
