CAS 1385696-77-4

2H-Pyran-4-amine, tetrahydro-4-[[2-(trifluoromethyl)phenyl]methyl]-, hydrochloride (1:1)

Description:

2H-Pyran-4-amine, tetrahydro-4-[[2-(trifluoromethyl)phenyl]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a pyran ring and a trifluoromethyl-substituted phenyl group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its handling in various applications. The presence of the trifluoromethyl group contributes to its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The tetrahydro configuration indicates that the compound is saturated, which can affect its reactivity and stability. As a hydrochloride, it is likely to exhibit properties typical of amines, such as basicity, and may participate in various chemical reactions, including nucleophilic substitutions. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and related fields, where its potential applications could be explored further.

Formula: C₁₃H₁₆F₃NO·ClH

InChI: InChI=1S/C13H16F3NO.ClH/c14-13(15,16)11-4-2-1-3-10(11)9-12(17)5-7-18-8-6-12;/h1-4H,5-9,17H2;1H

InChI key: InChIKey=XBEZRTQOMOUNMS-UHFFFAOYSA-N

SMILES: C(C1=C(C(F)(F)F)C=CC=C1)C2(N)CCOCC2.Cl

Synonyms:

• 2H-Pyran-4-amine, tetrahydro-4-[[2-(trifluoromethyl)phenyl]methyl]-, hydrochloride (1:1)

4-[2-(Trifluoromethyl)phenyl]methyl-oxan-4-amine hydrochloride

CAS: 1385696-77-4

Formula: C₁₃H₁₇ClF₃NO

Molecular weight: 295.73

Ref: 10-F097316