CymitQuimica logo

CAS 1385696-82-1

:

5-[(Tetrahydro-2H-pyran-4-yl)methoxy]-3-pyridinecarboxylic acid

Description:
5-[(Tetrahydro-2H-pyran-4-yl)methoxy]-3-pyridinecarboxylic acid is a chemical compound characterized by its unique structural features, which include a pyridine ring and a tetrahydro-2H-pyran moiety. The presence of the carboxylic acid functional group contributes to its acidic properties, while the methoxy group enhances its solubility in organic solvents. This compound may exhibit biological activity due to its structural similarity to various pharmacologically active substances, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by the functional groups present, affecting its behavior in different chemical environments. As with many organic compounds, the synthesis and purification methods are crucial for obtaining the desired purity and yield, which can impact its application in research or industry. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.
Formula:C12H15NO4
InChI:InChI=1S/C12H15NO4/c14-12(15)10-5-11(7-13-6-10)17-8-9-1-3-16-4-2-9/h5-7,9H,1-4,8H2,(H,14,15)
InChI key:InChIKey=RVHDWSQBFHNVMA-UHFFFAOYSA-N
SMILES:O(CC1CCOCC1)C=2C=C(C(O)=O)C=NC2
Synonyms:
  • 3-Pyridinecarboxylic acid, 5-[(tetrahydro-2H-pyran-4-yl)methoxy]-
  • 5-[(Tetrahydro-2H-pyran-4-yl)methoxy]-3-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.