CAS 138584-35-7
:(3S,4S,5S,6R)-6-[5-[2-[4-[[2-butyl-4-chloro-5-(hydroxymethyl)imidazol-1-yl]methyl]phenyl]phenyl]tetrazol-2-yl]-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic acid
Description:
The chemical substance with the name "(3S,4S,5S,6R)-6-[5-[2-[4-[[2-butyl-4-chloro-5-(hydroxymethyl)imidazol-1-yl]methyl]phenyl]phenyl]tetrazol-2-yl]-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic acid" and CAS number "138584-35-7" is a complex organic compound characterized by its multi-functional groups and stereochemistry. It features a tetrahydropyran ring, which contributes to its cyclic structure, and multiple hydroxyl groups that enhance its solubility and reactivity. The presence of a tetrazole moiety indicates potential bioactivity, as tetrazoles are often found in pharmaceuticals. Additionally, the compound contains a butyl group and a chloro substituent, which may influence its lipophilicity and biological interactions. The specific stereochemistry, denoted by the (3S,4S,5S,6R) configuration, suggests that the compound may exhibit chirality, potentially leading to different biological activities for its enantiomers. Overall, this substance is likely to be of interest in medicinal chemistry and pharmacology due to its intricate structure and potential therapeutic applications.
Formula:C28H31ClN6O7
InChI:InChI=1S/C28H31ClN6O7/c1-2-3-8-20-30-25(29)19(14-36)34(20)13-15-9-11-16(12-10-15)17-6-4-5-7-18(17)26-31-33-35(32-26)27-23(39)21(37)22(38)24(42-27)28(40)41/h4-7,9-12,21-24,27,36-39H,2-3,8,13-14H2,1H3,(H,40,41)/t21-,22-,23+,24-,27+/m0/s1
InChI key:InChIKey=NGFMQMUIOUSHGR-RTCYWULBSA-N
SMILES:C(C1=CC=C(C2=C(C=CC=C2)C3=NN(N=N3)[C@@H]4O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]4O)C=C1)N5C(CCCC)=NC(Cl)=C5CO
Synonyms:- 1-[5-[4′-[[2-Butyl-4-chloro-5-(hydroxymethyl)-1H-imidazol-1-yl]methyl][1,1′-biphenyl]-2-yl]-2H-tetrazol-2-yl]-1-deoxy-β-D-glucopyranuronic acid
- L 158783
- β-D-Glucopyranuronic acid, 1-[5-[4′-[[2-butyl-4-chloro-5-(hydroxymethyl)-1H-imidazol-1-yl]methyl][1,1′-biphenyl]-2-yl]-2H-tetrazol-2-yl]-1-deoxy-
- Losartan N2 Glucuronide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Losartan N2-glucuronide
CAS:Formula:C28H31ClN6O7Color and Shape:White To Off-White SolidMolecular weight:599.04Losartan N2-Glucuronide (90%)
CAS:Controlled ProductApplications A metabolite of Losartan (L470500).
References Stearns, R.A., et al.: Drug Metab. Dispos., 19, 1160 ( (1991), Chen, T.S., et al.: J. Antibiotics, 46, 131 (1993), Alonen, A., et al.: Bioorg. Chem., 36, 148 (2008),Formula:C28H31ClN6O7Purity:90%Color and Shape:Off-WhiteMolecular weight:599.03Losartan N2-Glucuronide-d4
CAS:Controlled ProductFormula:C28D4H27ClN6O7Color and Shape:NeatMolecular weight:603.059Losartan N2-glucuronide
CAS:Losartan N2-glucuronide is a custom synthesis that has been modified by fluorination, methylation, and monosaccharide modification. It is synthesized with click chemistry to create an oligosaccharide. This product is synthesized from saccharides (carbohydrates) and polysaccharides. Losartan glucuronide is a complex carbohydrate that has been glycosylated and sugar modified for high purity.
Formula:C28H31ClN6O7Purity:Min. 95%Color and Shape:White To Off-White SolidMolecular weight:599.03 g/mol




