CAS 13860-69-0: N-Methyl-N-nitrosoimidodicarbonic diamide

Description:N-Methyl-N-nitrosoimidodicarbonic diamide, with the CAS number 13860-69-0, is a chemical compound that belongs to the class of nitrosamines. It is characterized by the presence of a nitroso group (-NO) attached to a nitrogen atom within an imidodicarbonic diamide framework. This compound is typically a colorless to pale yellow solid and is known for its potential use in various chemical syntheses and as a reagent in organic chemistry. Due to the presence of the nitroso group, it may exhibit properties such as being a potential carcinogen, which necessitates careful handling and storage. The compound is soluble in polar solvents, and its reactivity can be influenced by the presence of other functional groups in a reaction mixture. As with many nitrosamines, it is important to consider its stability and the conditions under which it may decompose or react, particularly in the presence of acids or bases. Safety precautions should be taken when working with this substance due to its toxicological profile.

Formula:C₃H₆N₄O₃

InChI:InChI=1S/C3H6N4O3/c1-7(6-10)3(9)5-2(4)8/h1H3,(H3,4,5,8,9)

InChI key:InChIKey=YBODEWRZWWTHPL-UHFFFAOYSA-N

SMILES:O=NN(C(=O)NC(=O)N)C