CAS 138642-47-4
:2-Bromo-5-Methoxybenzonitrile
Description:
2-Bromo-5-methoxybenzonitrile is an organic compound characterized by its aromatic structure, which includes a bromine atom and a methoxy group attached to a benzene ring, along with a nitrile functional group. The presence of the bromine atom contributes to its reactivity, making it useful in various chemical synthesis processes, particularly in the formation of carbon-carbon bonds. The methoxy group enhances the compound's solubility in organic solvents and can influence its electronic properties, potentially affecting its reactivity and interaction with other molecules. As a nitrile, it features a carbon triple-bonded to a nitrogen atom, which imparts distinct chemical properties, including the ability to participate in nucleophilic addition reactions. This compound is typically used in research and development, particularly in the synthesis of pharmaceuticals and agrochemicals. Its physical properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances. Safety precautions should be observed when handling this compound due to its potential toxicity and reactivity.
Formula:C8H6BrNO
InChI:InChI=1/C8H6BrNO/c1-11-7-2-3-8(9)6(4-7)5-10/h2-4H,1H3
SMILES:COc1ccc(c(c1)C#N)Br
Synonyms:- Benzonitrile, 2-Bromo-5-Methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Bromo-5-methoxybenzonitrile, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H6BrNOPurity:98%Molecular weight:212.05Benzonitrile, 2-bromo-5-methoxy-
CAS:Formula:C8H6BrNOPurity:95%Color and Shape:SolidMolecular weight:212.04332-Bromo-5-methoxybenzonitrile
CAS:2-Bromo-5-methoxybenzonitrileFormula:C8H6BrNOPurity:98%Color and Shape: peach solidMolecular weight:212.04g/mol2-Bromo-5-methoxybenzonitrile
CAS:Formula:C8H6BrNOPurity:95%Color and Shape:SolidMolecular weight:212.0464-Bromo-3-cyanoanisole
CAS:4-Bromo-3-cyanoanisole is a potent inhibitor of the tyrosine kinase receptor. The functional theory behind this drug's mechanism of action is that it binds to the ATP binding site of the receptor and blocks ATP from binding, preventing downstream signaling. 4-Bromo-3-cyanoanisole has been shown to be an effective inhibitor of cancer cell proliferation. This drug has also been shown to inhibit microtubule assembly and disrupt cellular function by inhibiting protein synthesis.Formula:C8H6BrNOPurity:Min. 95%Color and Shape:PowderMolecular weight:212.04 g/mol




