CAS 138650-24-5
:3-Aminooxetane-3-carboxylic acid
Description:
3-Aminooxetane-3-carboxylic acid, with the CAS number 138650-24-5, is a chemical compound characterized by its unique oxetane ring structure, which contributes to its reactivity and potential applications in organic synthesis. This compound features an amino group and a carboxylic acid functional group, making it an amino acid derivative. The presence of these functional groups allows for various interactions, including hydrogen bonding, which can influence its solubility and reactivity in different solvents. The oxetane ring provides a three-membered cyclic structure that can strain the molecule, potentially leading to interesting chemical behavior during reactions. This compound may be of interest in medicinal chemistry and materials science due to its potential as a building block for more complex molecules. Additionally, its structural features may impart specific biological activities, making it a candidate for further research in pharmaceutical applications. Overall, 3-Aminooxetane-3-carboxylic acid represents a versatile compound with promising implications in various fields of chemistry.
Formula:C4H7NO3
InChI:InChI=1/C4H7NO3/c5-4(3(6)7)1-8-2-4/h1-2,5H2,(H,6,7)
SMILES:C1C(CO1)(C(=O)O)N
Synonyms:- 3-Oxetanecarboxylic acid, 3-amino-
- 3-Amino-3-oxetanecarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Aminooxetane-3-carboxylic acid, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C4H7NO3Purity:95%Molecular weight:117.13-Oxetanecarboxylic acid, 3-amino-
CAS:Formula:C4H7NO3Purity:97%Color and Shape:SolidMolecular weight:117.10333-Aminooxetane-3-carboxylic acid
CAS:3-Aminooxetane-3-carboxylic acid
Purity:95%Molecular weight:117.10g/mol3-Aminooxetane-3-carboxylic acid
CAS:Formula:C4H7NO3Purity:97%Color and Shape:SolidMolecular weight:117.104



