CAS 138662-63-2
:boc-3,3-diphenyl-L-alanine
Description:
Boc-3,3-diphenyl-L-alanine is a protected form of the amino acid L-alanine, characterized by the presence of a tert-butyloxycarbonyl (Boc) group, which serves as a protective group for the amino functionality. This compound features two phenyl groups attached to the alpha carbon, contributing to its hydrophobic character and influencing its solubility and reactivity. The Boc group enhances the stability of the amino acid during synthetic procedures, allowing for selective reactions without interference from the amino group. Typically, Boc-3,3-diphenyl-L-alanine is utilized in peptide synthesis and medicinal chemistry, where it can serve as a building block for more complex molecules. Its structural features may also impart unique biological activities, making it of interest in drug design and development. The compound is generally handled with standard laboratory safety precautions, and its properties, such as melting point and solubility, can vary based on the specific conditions and solvents used.
Formula:C20H23NO4
InChI:InChI=1/C20H23NO4/c1-20(2,3)25-19(24)21-17(18(22)23)13-14-8-7-11-16(12-14)15-9-5-4-6-10-15/h4-12,17H,13H2,1-3H3,(H,21,24)(H,22,23)/t17-/m0/s1
SMILES:CC(C)(C)OC(=N[C@@H](Cc1cccc(c1)c1ccccc1)C(=O)O)O
Synonyms:- Boc-L-3,3-Diphenylalanine
- N-(tert-Butoxycarbonyl)-3-phenyl-L-phenylalanine
- N-(tert-Butoxycarbonyl)-beta-phenyl-L-phenylalanine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-Boc-3,3-diphenyl-L-alanine, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C20H23NO4Purity:95%Molecular weight:341.41L-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-b-phenyl-
CAS:Formula:C20H23NO4Purity:98%Color and Shape:SolidMolecular weight:341.40093,3-Diphenyl-L-alanine, N-BOC protected
CAS:3,3-Diphenyl-L-alanine, N-BOC protectedFormula:C20H23NO4Purity:98%Color and Shape: white solidMolecular weight:341.40092g/mol(S)-N-Boc-2-Amino-3,3-diphenylpropionic acid
CAS:Formula:C20H23NO4Purity:98%Color and Shape:SolidMolecular weight:341.407





