CAS 138689-79-9

5-[4-(Methylthio)phenyl]-1H-tetrazole

Description:

5-[4-(Methylthio)phenyl]-1H-tetrazole is an organic compound characterized by its tetrazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom. The presence of a methylthio group attached to a phenyl ring enhances its chemical reactivity and solubility properties. This compound is typically used in medicinal chemistry and may exhibit biological activity, making it of interest for pharmaceutical applications. Its molecular structure suggests potential interactions with biological targets, which can be explored for therapeutic purposes. The compound is likely to be stable under standard conditions but may undergo reactions typical of tetrazoles, such as nucleophilic substitutions or cycloadditions. Additionally, its solubility in various solvents can vary, influencing its application in different chemical environments. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices. Overall, 5-[4-(Methylthio)phenyl]-1H-tetrazole represents a versatile building block in organic synthesis and drug development.

Formula: C₈H₈N₄S

InChI: InChI=1/C8H8N4S/c1-13-7-4-2-6(3-5-7)8-9-11-12-10-8/h2-5H,1H3,(H,9,10,11,12)

SMILES: CSc1ccc(cc1)c1n[nH]nn1

Synonyms:

• 5-[4-(methylsulfanyl)phenyl]-2H-tetrazole

5-[4-(methylsulfanyl)phenyl]-2H-1,2,3,4-tetrazole

CAS: 138689-79-9

Formula: C₈H₈N₄S

Purity: 98%

Molecular weight: 192.2409

Ref: IN-DA001915