CAS 138715-82-9
:methyl 2-acetylpyridine-4-carboxylate
Description:
Methyl 2-acetylpyridine-4-carboxylate, identified by its CAS number 138715-82-9, is an organic compound that features a pyridine ring substituted with both an acetyl group and a carboxylate group. This compound typically appears as a yellow to brown liquid or solid, depending on its purity and specific conditions. It is characterized by its aromatic nature, which contributes to its stability and reactivity. The presence of the acetyl group provides ketone-like properties, making it a potential candidate for various chemical reactions, including condensation and acylation. Additionally, the carboxylate moiety enhances its solubility in polar solvents and can participate in hydrogen bonding. Methyl 2-acetylpyridine-4-carboxylate is of interest in synthetic organic chemistry and may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its unique structure allows for diverse applications, including potential use in flavoring and fragrance industries, as well as in the development of novel materials. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H9NO3
InChI:InChI=1/C9H9NO3/c1-6(11)8-5-7(3-4-10-8)9(12)13-2/h3-5H,1-2H3
SMILES:CC(=O)c1cc(ccn1)C(=O)OC
Synonyms:- 2-Acétylisonicotinate de méthyle
- 2-Acetyl-isonicotinic acid methyl ester
- 4-Pyridinecarboxylic Acid, 2-Acetyl-, Methyl Ester
- Methyl 2-acetylisonicotinate
- Methyl-2-acetylisonicotinat
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Acetyl-isonicotinic acid methyl ester
CAS:Formula:C9H9NO3Purity:97%Color and Shape:SolidMolecular weight:179.1727Methyl 2-Acetylpyridine-4-carboxylate
CAS:Methyl 2-Acetylpyridine-4-carboxylatePurity:98%Molecular weight:179.17g/molMethyl 2-acetylisonicotinate
CAS:Formula:C9H9NO3Purity:97%Color and Shape:SolidMolecular weight:179.175Methyl 2-Acetylpyridine-4-carboxylate
CAS:<p>Methyl 2-acetylpyridine-4-carboxylate is a photocurrent generating compound that can be used in organic solar cells. It has been shown to enhance the performance of organic solar cells by acting as a bidentate ligand for ruthenium complexes. Methyl 2-acetylpyridine-4-carboxylate is synthesized from the diacid, acetylene and formaldehyde. It can be used as an electron acceptor in coordination chemistry involving anthracene to produce a Ru(II) complex. The electron donor is usually a metal ion such as ruthenium, which can be activated by light or heat to generate electrons.</p>Formula:C9H9NO3Purity:Min. 95%Molecular weight:179.17 g/mol



