CymitQuimica logo

CAS 138733-50-3

:

2-Bromo-N-(tert-butyl)benzenesulphonamide

Description:
2-Bromo-N-(tert-butyl)benzenesulphonamide is an organic compound characterized by its sulphonamide functional group, which is attached to a benzene ring that also features a bromine atom and a tert-butyl substituent. This compound typically appears as a solid and is known for its moderate solubility in organic solvents. The presence of the bromine atom introduces electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. The tert-butyl group enhances the steric hindrance around the nitrogen atom, influencing its reactivity and interactions with other molecules. Additionally, the sulphonamide group contributes to the compound's potential biological activity, as sulphonamides are known for their antimicrobial properties. Overall, 2-Bromo-N-(tert-butyl)benzenesulphonamide serves as a valuable intermediate in organic synthesis and may have applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its unique structural features make it a subject of interest for further research in both synthetic and medicinal chemistry contexts.
Formula:C10H14BrNO2S
InChI:InChI=1/C10H14BrNO2S/c1-10(2,3)12-15(13,14)9-7-5-4-6-8(9)11/h4-7,12H,1-3H3
InChI key:AMQGWGSNHQLIJT-UHFFFAOYSA-N
SMILES:CC(C)(C)NS(=O)(=O)c1ccccc1Br
Synonyms:
  • 2-Bromo-N-tert-butylbenzenesulfonamide
  • N-t-Butyl 2-bromobenzenesulfonamide
  • 2-Bromo-N-(1,1-Dimethylethyl)Benzenesulfonamide
Found 4 products.