CAS 1387445-53-5

4-[[(1,1-Dimethylethoxy)carbonyl]amino]-3-methylbutanoic acid

Description:

4-[[(1,1-Dimethylethoxy)carbonyl]amino]-3-methylbutanoic acid, with the CAS number 1387445-53-5, is an organic compound characterized by its complex structure that includes an amino acid backbone modified with a dimethylethoxycarbonyl group. This compound typically features a carboxylic acid functional group, which contributes to its acidic properties, and an amine group that can participate in various chemical reactions, including peptide bond formation. The presence of the dimethylethoxycarbonyl group enhances its stability and solubility in organic solvents, making it useful in synthetic chemistry, particularly in the context of peptide synthesis and drug development. The branched structure of the 3-methylbutanoic acid component can influence its steric properties and reactivity. Overall, this compound is of interest in medicinal chemistry and biochemistry due to its potential applications in the synthesis of biologically active molecules. Its specific characteristics, such as melting point, boiling point, and solubility, would require empirical data for precise determination.

Formula: C₁₀H₁₉NO₄

InChI: InChI=1S/C10H19NO4/c1-7(5-8(12)13)6-11-9(14)15-10(2,3)4/h7H,5-6H2,1-4H3,(H,11,14)(H,12,13)

InChI key: InChIKey=FNYRVJJDNPAVSS-UHFFFAOYSA-N

SMILES: O(C(NCC(CC(O)=O)C)=O)C(C)(C)C

Synonyms:

• 4-[[(1,1-Dimethylethoxy)carbonyl]amino]-3-methylbutanoic acid
• Butanoic acid, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-3-methyl-

4-{[(tert-Butoxy)carbonyl]amino}-3-methylbutanoic acid

CAS: 1387445-53-5

Versatile small molecule scaffold

Formula: C₁₀H₁₉NO₄

Purity: Min. 95%

Molecular weight: 217.26 g/mol

Ref: 3D-MFC44553