
CAS 13877-76-4
:Formycin B
Description:
Formycin B, with the CAS number 13877-76-4, is a purine nucleoside analog that exhibits notable biological activity. It is derived from the fermentation of certain microorganisms, particularly Streptomyces species. Formycin B is characterized by its structure, which includes a ribose sugar linked to a purine base, specifically hypoxanthine. This compound is known for its antiviral properties, particularly against certain RNA viruses, and has been studied for its potential therapeutic applications. Additionally, Formycin B can inhibit nucleoside transport and has been shown to interfere with nucleic acid synthesis, making it of interest in the field of medicinal chemistry. Its solubility in water and stability under physiological conditions contribute to its utility in research. Overall, Formycin B represents a significant compound in the study of nucleoside analogs and their effects on biological systems.
Formula:C10H12N4O5
InChI:InChI=1S/C10H12N4O5/c15-1-3-7(16)8(17)9(19-3)5-4-6(14-13-5)10(18)12-2-11-4/h2-3,7-9,15-17H,1H2,(H,13,14)(H,11,12,18)/t3-,7-,8-,9+/m1/s1
InChI key:InChIKey=MTCJZZBQNCXKAP-KSYZLYKTSA-N
SMILES:O[C@H]1[C@H](C=2C3=C(NN2)C(=O)N=CN3)O[C@H](CO)[C@H]1O
Synonyms:- Ohyamycin
- Formycin B
- 1,6-Dihydro-3-β-D-ribofuranosyl-7H-pyrazolo[4,3-d]pyrimidin-7-one
- 7H-Pyrazolo[4,3-d]pyrimidin-7-one, 1,6-dihydro-3-β-D-ribofuranosyl-
- 7H-Pyrazolo[4,3-d]pyrimidin-7-one, 1,4-dihydro-3-β-D-ribofuranosyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Formycin B
CAS:<p>Formycin B is a model nucleoside analog.</p>Formula:C10H12N4O5Color and Shape:SolidMolecular weight:268.23
