CAS 13878-92-7
:Isomangiferolic acid
Description:
Isomangiferolic acid is a naturally occurring compound classified as a flavonoid, specifically a type of polyphenolic compound. It is primarily derived from the mango tree (Mangifera indica) and is known for its potential health benefits. This compound exhibits various biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties, making it of interest in both nutritional and pharmaceutical research. Isomangiferolic acid has been studied for its potential role in protecting cells from oxidative stress and its ability to modulate various signaling pathways. Its chemical structure features multiple hydroxyl groups, contributing to its reactivity and interaction with biological systems. Additionally, it is soluble in organic solvents, which influences its bioavailability and efficacy in different formulations. Research continues to explore its therapeutic potential, particularly in the context of chronic diseases and metabolic disorders. Overall, isomangiferolic acid represents a significant area of interest in the study of natural products and their applications in health and medicine.
Formula:C30H48O3
InChI:InChI=1S/C30H48O3/c1-19(8-7-9-20(2)25(32)33)21-12-14-28(6)23-11-10-22-26(3,4)24(31)13-15-29(22)18-30(23,29)17-16-27(21,28)5/h9,19,21-24,31H,7-8,10-18H2,1-6H3,(H,32,33)/b20-9+/t19-,21-,22+,23+,24-,27-,28+,29-,30+/m1/s1
InChI key:InChIKey=CYHOTEDWAOHQLA-AKGXXHIGSA-N
SMILES:C[C@]12[C@]3([C@]4([C@]5(C4)[C@](C(C)(C)[C@H](O)CC5)(CC3)[H])CC[C@]1(C)[C@@]([C@@H](CC/C=C(/C(O)=O)\C)C)(CC2)[H])[H]
Synonyms:- (3α,24E)-3-Hydroxy-9,19-cyclolanost-24-en-26-oic acid
- 9,19-Cyclo-9b-lanost-24-en-26-oic acid, 3a-hydroxy- (8CI)
- 9,19-Cyclo-9β-lanost-24-en-26-oic acid, 3α-hydroxy-
- 9,19-Cyclolanost-24-en-26-oic acid, 3-hydroxy-, (3α,24E)-
- Isomangiferolic acid
- Isomangiferolicacid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
9,19-Cyclolanost-24-en-26-oic acid, 3-hydroxy-, (3α,24E)-
CAS:Formula:C30H48O3Purity:98.0%Molecular weight:456.7003Isomangiferolic acid
CAS:Isomangiferolic acid is a natural product of Mangifera, Anacardiaceae.Formula:C30H48O3Purity:98%Color and Shape:SolidMolecular weight:456.7Isomangiferolic acid
CAS:Formula:C30H48O3Purity:95%~99%Color and Shape:PowderMolecular weight:456.711Isomangiferolic acid
CAS:Isomangiferolic acid is a natural organic compound, which is derived primarily from the bark, leaves, and fruit of mango trees (Mangifera indica). This compound is a type of phenolic acid, structurally characterized by its carboxylic acid group attached to a phenol backbone. Extracted through organic solvent methods, it embodies the biochemical complexity inherent in plant secondary metabolites.Formula:C30H48O3Purity:Min. 95%Molecular weight:456.7 g/mol



