CAS 138799-98-1
:Methyl 1-(aminomethyl)-1-cyclohexaneacetate
Description:
Methyl 1-(aminomethyl)-1-cyclohexaneacetate, identified by its CAS number 138799-98-1, is an organic compound characterized by its ester functional group and the presence of an amino group. This compound features a cyclohexane ring, which contributes to its cyclic structure, and an acetate moiety, indicating that it is derived from acetic acid. The amino group attached to the cyclohexane enhances its potential for forming hydrogen bonds, which can influence its solubility and reactivity. Typically, compounds like this may exhibit moderate polarity due to the presence of both hydrophobic (cyclohexane) and hydrophilic (amino and ester) components. Methyl 1-(aminomethyl)-1-cyclohexaneacetate may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing more complex molecules. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied.
Formula:C10H19NO2
InChI:InChI=1S/C10H19NO2/c1-13-9(12)7-10(8-11)5-3-2-4-6-10/h2-8,11H2,1H3
InChI key:InChIKey=SYKKFHNKTXXXCK-UHFFFAOYSA-N
SMILES:C(C(OC)=O)C1(CN)CCCCC1
Synonyms:- Methyl 1-(aminomethyl)-1-cyclohexaneacetate
- Cyclohexaneacetic acid, 1-(aminomethyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Gabapentin Methyl Ester Trifluoroacetate
CAS:Formula:C10H19NO2·C2HF3O2Color and Shape:White To Off-White SolidMolecular weight:185.27 114.02

