CAS 1388035-56-0: (2,3-Difluorophenyl)-4-piperidinylmethanone

Description:(2,3-Difluorophenyl)-4-piperidinylmethanone is a chemical compound characterized by its unique structure, which includes a piperidine ring and a difluorophenyl group. The presence of fluorine atoms in the phenyl ring enhances the compound's lipophilicity and may influence its biological activity. This compound is typically classified as an organic molecule and may exhibit properties such as moderate to high solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the piperidine moiety, which is often found in various bioactive compounds. The compound's reactivity may be influenced by the functional groups present, allowing for potential modifications that could enhance its efficacy or selectivity in biological systems. As with many synthetic organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on its use and concentration.

Formula:C₁₂H₁₃F₂NO

InChI:InChI=1S/C12H13F2NO/c13-10-3-1-2-9(11(10)14)12(16)8-4-6-15-7-5-8/h1-3,8,15H,4-7H2

InChI key:InChIKey=LTVAJIZVPQXETB-UHFFFAOYSA-N

SMILES:O=C(C=1C=CC=C(F)C1F)C2CCNCC2

Synonyms:
(2,3-Difluorophenyl)-4-piperidinylmethanone
Methanone, (2,3-difluorophenyl)-4-piperidinyl-

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	4-(2,3-Difluorobenzoyl)piperidine REF: TR-D445320CAS: 1388035-56-0	- - -	5,796.00 €	Tue 06 May 25
	4-(2,3-Difluorobenzoyl)piperidine REF: 3D-NFC03556CAS: 1388035-56-0	Min. 95%	- - -	Discontinued product