CymitQuimica logo

CAS 138846-61-4

:

Phenol, 2-[[bis(2-aminoethyl)amino]methyl]-4-octyl-

Description:
Phenol, 2-[[bis(2-aminoethyl)amino]methyl]-4-octyl-, also known by its CAS number 138846-61-4, is an organic compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. This compound features a long octyl chain, contributing to its hydrophobic properties, while the presence of the bis(2-aminoethyl)amino group introduces significant hydrophilicity and potential for hydrogen bonding. As a result, it exhibits amphiphilic characteristics, making it useful in various applications, including surfactants and emulsifiers. The amino groups can participate in various chemical reactions, including those involving nucleophilic substitution or complexation with metal ions. Additionally, the compound may exhibit biological activity, which could be relevant in pharmaceutical or biochemical contexts. Its solubility in organic solvents and limited solubility in water reflects its structural balance between hydrophobic and hydrophilic regions. Overall, this compound's unique combination of functional groups and hydrophobicity makes it a subject of interest in both industrial and research settings.
Formula:C19H35N3O
InChI:InChI=1S/C19H35N3O/c1-2-3-4-5-6-7-8-17-9-10-19(23)18(15-17)16-22(13-11-20)14-12-21/h9-10,15,23H,2-8,11-14,16,20-21H2,1H3
InChI key:InChIKey=LMCAMLYOZZMHPI-UHFFFAOYSA-N
SMILES:C(N(CCN)CCN)C1=CC(CCCCCCCC)=CC=C1O
Synonyms:
  • 2-[[Bis(2-aminoethyl)amino]methyl]-4-octylphenol
  • Phenol, 2-[[bis(2-aminoethyl)amino]methyl]-4-octyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.