CAS 13885-09-1
:2-(Diphenylphosphino)-biphenyl
Description:
2-(Diphenylphosphino)-biphenyl, with the CAS number 13885-09-1, is a chemical compound characterized by its unique structure that features a biphenyl backbone substituted with a diphenylphosphino group. This compound is typically a white to light yellow solid and is known for its role as a ligand in coordination chemistry, particularly in transition metal complexes. The presence of the phosphorus atom allows for strong coordination with metals, making it valuable in catalysis and organic synthesis. Its steric and electronic properties can significantly influence the reactivity and selectivity of metal-catalyzed reactions. Additionally, 2-(Diphenylphosphino)-biphenyl exhibits good thermal stability and solubility in organic solvents, which enhances its utility in various chemical applications. Safety data indicates that, like many organophosphorus compounds, it should be handled with care due to potential toxicity. Overall, this compound is an important tool in modern synthetic chemistry, particularly in the development of new catalytic processes.
Formula:C24H19P
InChI:InChI=1/C24H19P/c1-4-12-20(13-5-1)23-18-10-11-19-24(23)25(21-14-6-2-7-15-21)22-16-8-3-9-17-22/h1-19H
SMILES:c1ccc(cc1)c1ccccc1P(c1ccccc1)c1ccccc1
Synonyms:- Biphenyl-2-Yl(Diphenyl)Phosphane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-(Diphenylphosphino)biphenyl
CAS:Formula:C24H19PPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:338.392-(Diphenylphosphino)biphenyl, 98%
CAS:<p>2-(Diphenylphosphino)biphenyl is used as an organic chemical synthesis intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item </p>Formula:C24H19PPurity:98%Color and Shape:Solid, WhiteMolecular weight:338.39Phosphine, [1,1'-biphenyl]-2-yldiphenyl-
CAS:Formula:C24H19PPurity:97%Color and Shape:SolidMolecular weight:338.38142-(Diphenylphosphino)biphenyl
CAS:<p>2-(Diphenylphosphino)biphenyl</p>Formula:C24H19PPurity:≥95%Color and Shape: white crystalline solidMolecular weight:338.38142g/mol2-(Diphenylphosphino)biphenyl
CAS:Formula:C24H19PPurity:95%Color and Shape:SolidMolecular weight:338.392-(Diphenylphosphinobiphenyl
CAS:Controlled Product<p>Applications 2-(DIPHENYLPHOSPHINO)-BIPHENYL (cas# 13885-09-1) is a useful research chemical.<br></p>Formula:C24H19PColor and Shape:NeatMolecular weight:338.38





