CAS 13887-98-4: 3,6,9-trioxaundecanedioic acid
Description:3,6,9-Trioxaundecanedioic acid, with the CAS number 13887-98-4, is a polyfunctional organic compound characterized by the presence of three ether linkages and two carboxylic acid groups within its molecular structure. This compound is a member of the family of polycarboxylic acids, which are known for their ability to form chelates with metal ions, making them useful in various applications, including coordination chemistry and materials science. The trioxaundecanedioic acid features a long carbon chain, contributing to its unique physical properties, such as solubility in polar solvents and potential for forming hydrogen bonds. Its structure allows for potential applications in the synthesis of biodegradable polymers, surfactants, and as a building block in organic synthesis. Additionally, the presence of multiple functional groups enhances its reactivity, making it a versatile compound in chemical reactions. Overall, 3,6,9-trioxaundecanedioic acid is notable for its structural complexity and potential utility in various chemical and industrial applications.
Formula:C8H14O7
InChI:InChI=1S/C8H14O7/c9-7(10)5-14-3-1-13-2-4-15-6-8(11)12/h1-6H2,(H,9,10)(H,11,12)
InChI key:InChIKey=HJZZQNLKBWJYPD-UHFFFAOYSA-N
SMILES:O=C(O)COCCOCCOCC(=O)O
- Synonyms:
- 2,2'-(Oxybis(2,1-ethanediyloxy))bisacetic acid
- 2,2'-[Oxybis(Ethane-2,1-Diyloxy)]Diacetic Acid
- 2,2′-[Oxybis(2,1-ethanediyloxy)]bis[acetic acid]
- 2-(2-(Carboxymethoxy)ethoxy)ethoxyacetic acid
- 3,6,9-Trioxaundecandioic acid
- 3,6,9-Trioxaundecane-1,11-dioic acid
- Acetic acid, (oxybis(2,1-ethanediyloxy))bis-
- Acetic acid, 2,2′-[oxybis(2,1-ethanediyloxy)]bis-
- Acetic acid, [oxybis(ethyleneoxy)]di-
- Bis[2-(carboxymethoxy)ethyl] ether
- See more synonyms
- Diethylene glycol bis(carboxymethyl ether)
- Tetraglycolic acid
- [2-{2-(Carboxymethoxy)ethoxy}ethoxy]acetic acid
- 3,6,9-Trioxaundecanedioic acid

Acetic acid, 2,2'-[oxybis(2,1-ethanediyloxy)]bis-
Ref: IN-DA0019QT
1g | 47.00 € | ||
5g | 90.00 € | ||
25g | 182.00 € | ||
100g | 540.00 € | ||
250mg | 26.00 € |

2,2?-((Oxybis(Ethane-2,1-Diyl))Bis(Oxy))Diacetic Acid
Ref: 54-OR1009896
1g | 78.00 € | ||
5g | 125.00 € | ||
25g | 542.00 € | ||
100g | 1,957.00 € | ||
100mg | 32.00 € | ||
250mg | 36.00 € |

3,6,9-Trioxaundecanedioic Acid
Ref: TM-T14028
100mg | To inquire | ||
500mg | To inquire |

2,2'-((Oxybis(ethane-2,1-diyl))bis(oxy))diacetic acid
Ref: 10-F436122
1g | 24.00 € | ||
5g | 72.00 € | ||
10g | 110.00 € | ||
25g | 252.00 € |

3,6,9-Trioxaundecanedioic acid
Ref: 3D-FR168388
100g | Discontinued | Request information |