CymitQuimica logo

CAS 138877-09-5

:

benzyl (2R,3aR,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylate hydrochloride

Description:
Benzyl (2R,3aR,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylate hydrochloride is a chemical compound characterized by its complex bicyclic structure, which includes a cyclopentane and pyrrole moiety. This compound features a carboxylate functional group, contributing to its potential as a bioactive molecule. The presence of the benzyl group enhances its lipophilicity, which may influence its pharmacokinetic properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various applications, including pharmaceuticals. The stereochemistry indicated by the (2R,3aR,6aR) configuration suggests specific spatial arrangements of atoms, which can significantly affect the compound's biological activity and interactions with biological targets. Overall, this compound's unique structural features and functional groups make it of interest in medicinal chemistry and drug development, particularly in the context of exploring its therapeutic potential.
Formula:C15H20ClNO2
InChI:InChI=1/C15H19NO2.ClH/c17-15(18-10-11-5-2-1-3-6-11)14-9-12-7-4-8-13(12)16-14;/h1-3,5-6,12-14,16H,4,7-10H2;1H/t12-,13-,14-;/m1./s1
SMILES:c1ccc(cc1)COC(=O)[C@H]1C[C@H]2CCC[C@H]2N1.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.