CymitQuimica logo

CAS 13888-78-3

:

Silane, methylbis(pentafluorophenyl)-

Description:
Methylbis(pentafluorophenyl)silane, with the CAS number 13888-78-3, is an organosilicon compound characterized by the presence of a silicon atom bonded to two distinct groups: a methyl group and two pentafluorophenyl groups. This compound exhibits a high degree of fluorination, which imparts unique properties such as increased hydrophobicity and thermal stability. The pentafluorophenyl groups contribute to its electron-withdrawing characteristics, making it useful in various applications, including as a precursor in the synthesis of advanced materials and in surface modification processes. Silanes like this one are often utilized in the development of coatings, adhesives, and sealants due to their ability to enhance adhesion and improve chemical resistance. Additionally, the presence of fluorine atoms can enhance the compound's performance in specific environments, such as those requiring resistance to solvents or high temperatures. Overall, methylbis(pentafluorophenyl)silane is a valuable compound in materials science and chemical engineering, particularly in applications where fluorinated compounds are advantageous.
Formula:C13H4F10Si
InChI:InChI=1S/C13H4F10Si/c1-24(12-8(20)4(16)2(14)5(17)9(12)21)13-10(22)6(18)3(15)7(19)11(13)23/h24H,1H3
InChI key:InChIKey=HLWFCNUSBUPHNL-UHFFFAOYSA-N
SMILES:[SiH](C)(C1=C(F)C(F)=C(F)C(F)=C1F)C2=C(F)C(F)=C(F)C(F)=C2F
Synonyms:
  • Silane, methylbis(pentafluorophenyl)-
  • Methylbis(pentafluorophenyl)silane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.