CAS 138904-35-5

7-amino-5-oxo-4H-pyrazolo[1,5-a]pyrimidine-3-carbonitrile

Description:

7-amino-5-oxo-4H-pyrazolo[1,5-a]pyrimidine-3-carbonitrile, with the CAS number 138904-35-5, is a heterocyclic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both a pyrazole and a pyrimidine ring. This compound features an amino group at the 7-position and a carbonitrile group at the 3-position, contributing to its potential reactivity and biological activity. The presence of the carbonitrile group enhances its polarity and may influence its solubility in various solvents. The 5-oxo group indicates the presence of a carbonyl functionality, which can participate in various chemical reactions, including nucleophilic attacks. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory and anticancer activities. Its unique structural features make it a candidate for further research in drug development and synthesis of novel therapeutic agents. As with many heterocycles, its reactivity and interactions with biological targets can be influenced by the specific functional groups present in its structure.

Formula: C₇H₅N₅O

InChI: InChI=1/C7H5N5O/c8-2-4-3-10-12-5(9)1-6(13)11-7(4)12/h1,3H,9H2,(H,11,13)

SMILES: c1c(N)n2c(c(C#N)cn2)nc1O

Synonyms:

• 7-Amino-4,5-dihydro-5-oxo-pyrazolo[1,5-a]pyrimidine-3-carbonitrile

Pyrazolo[1,5-a]pyrimidine-3-carbonitrile, 7-amino-4,5-dihydro-5-oxo-

CAS: 138904-35-5

Formula: C₇H₅N₅O

Purity: 95%

Color and Shape: Solid

Molecular weight: 175.1475

Ref: IN-DA0019SN

7-Amino-5-oxo-4,5-dihydropyrazolo[1,5-a]pyrimidine-3-carbonitrile

CAS: 138904-35-5

7-Amino-5-oxo-4,5-dihydropyrazolo[1,5-a]pyrimidine-3-carbonitrile

Purity: 95%

Molecular weight: 175.15g/mol

Ref: 54-OR92940

7-amino-5-oxo-1H,5H-pyrazolo[1,5-a]pyrimidine-3-carbonitrile

CAS: 138904-35-5

Purity: 95%

Molecular weight: 175.151001

Ref: 10-F608622