CAS 138906-41-9: 4-METHOXYPHENYL 3,4,6-TRI-O-ACETYL-2-DEOXY-2-PHTHALIMIDO-BETA-D-GLUCOPYRANOSIDE
Description:4-Methoxyphenyl 3,4,6-tri-O-acetyl-2-deoxy-2-phthalimido-β-D-glucopyranoside is a complex organic compound characterized by its glycosidic structure, which includes a glucopyranoside moiety. This compound features multiple acetyl groups, which enhance its solubility and stability, and a methoxyphenyl group that contributes to its aromatic properties. The presence of the phthalimido group indicates potential applications in medicinal chemistry, particularly in the development of glycosylated compounds for drug delivery or targeting. Its molecular structure suggests it may exhibit specific biological activities, possibly related to its interactions with enzymes or receptors. The compound is likely to be soluble in organic solvents due to its acetyl and aromatic components, while its stability may be influenced by the acetylation of hydroxyl groups. Overall, this compound represents a significant interest in synthetic organic chemistry and biochemistry, particularly in the context of carbohydrate chemistry and the design of glycosides with potential therapeutic applications.
Formula:C27H27NO11
InChI:InChI=1/C27H27NO11/c1-14(29)35-13-21-23(36-15(2)30)24(37-16(3)31)22(27(39-21)38-18-11-9-17(34-4)10-12-18)28-25(32)19-7-5-6-8-20(19)26(28)33/h5-12,21-24,27H,13H2,1-4H3/t21-,22-,23-,24-,27-/m1/s1
- Synonyms:
- 4-Methoxyphenyl3,4,6-tri-O-acetyl-2-deoxy-2-phthalimido-b-D-glucopyranoside
- 4-methoxyphenyl 3,4,6-tri-O-acetyl-2-deoxy-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-β-D-glucopyranoside

β-D-Glucopyranoside, 4-methoxyphenyl 2-deoxy-2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-, 3,4,6-triacetate
Ref: IN-DA0019SJ
1g | 55.00 € | ||
250mg | 41.00 € |

4-Methoxyphenyl 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-β-D-glucopyranoside
Ref: 3B-M1480
5g | 97.00 € |

4-Methoxyphenyl 3,4,6-tri-O-acetyl-2-deoxy-2-phthalimido-b-D-glucopyranoside
Ref: 3D-MM06595
1g | 150.00 € | ||
2g | 200.00 € | ||
5g | 336.00 € | ||
10g | 598.00 € |