CAS 138906-44-2
:4-METHOXYPHENYL 3-O-BENZYL-2-DEOXY-2-PHTHALIMIDO-BETA-D-GLUCOPYRANOSIDE
Description:
4-Methoxyphenyl 3-O-benzyl-2-deoxy-2-phthalimido-β-D-glucopyranoside, with the CAS number 138906-44-2, is a synthetic glycoside characterized by its complex structure, which includes a glucopyranoside moiety linked to a benzyl and a methoxyphenyl group. This compound typically exhibits properties associated with glycosides, such as solubility in polar solvents and potential biological activity due to its sugar and aromatic components. The presence of the phthalimido group may impart specific reactivity or biological interactions, making it of interest in medicinal chemistry. Its methoxy and benzyl substituents can influence its lipophilicity and overall pharmacokinetic properties. As a chemical entity, it may be studied for its potential applications in drug development, particularly in targeting specific biological pathways or as a prodrug. However, detailed studies on its biological activity, toxicity, and pharmacological profile would be necessary to fully understand its characteristics and potential uses in therapeutic contexts.
Formula:C28H27NO8
InChI:InChI=1/C28H27NO8/c1-34-18-11-13-19(14-12-18)36-28-23(29-26(32)20-9-5-6-10-21(20)27(29)33)25(24(31)22(15-30)37-28)35-16-17-7-3-2-4-8-17/h2-14,22-25,28,30-31H,15-16H2,1H3/t22-,23-,24-,25-,28-/m1/s1
SMILES:COc1ccc(cc1)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)OCc1ccccc1)N1C(=O)c2ccccc2C1=O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Methoxyphenyl 3-O-Benzyl-2-deoxy-2-phthalimido-β-D-glucopyranoside
CAS:Formula:C28H27NO8Color and Shape:SolidMolecular weight:505.52β-D-Glucopyranoside, 4-methoxyphenyl 2-deoxy-2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-3-O-(phenylmethyl)-
CAS:Formula:C28H27NO8Molecular weight:505.51594-Methoxyphenyl 3-O-benzyl-2-deoxy-2-phthalimido-b-D-glucopyranoside
CAS:<p>4-Methoxyphenyl 3-O-benzyl-2-deoxy-2-phthalimido-b-D-glucopyranoside is an antiviral agent that inhibits the replication of papilloma virus and other viruses. It binds to the viral DNA at a site that is not affected by other antiviral agents, preventing the viral DNA from being copied into RNA. 4MPBG also induces coagulation and cell expression in human cells and has been shown to inhibit the production of amyloid beta (Aβ) in Alzheimer's disease. This drug is not active against organisms such as bacteria, yeast, or fungi. The drug was originally synthesized as a potential pharmaceutical for cancer treatment, but it did not exhibit any cytotoxic effects on cancer cells.</p>Formula:C28H27NO8Purity:Min. 95%Molecular weight:505.52 g/mol
