CymitQuimica logo

CAS 138907-70-7

:

Ethyl 5-amino-1-(3-fluorophenyl)-1H-pyrazole-4-carboxylate

Description:
Ethyl 5-amino-1-(3-fluorophenyl)-1H-pyrazole-4-carboxylate is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of an amino group at the 5-position and a carboxylate ester at the 4-position contributes to its reactivity and potential biological activity. The 3-fluorophenyl substituent enhances its lipophilicity and may influence its interaction with biological targets. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. Additionally, the fluorine atom can impart unique electronic properties, potentially affecting the compound's pharmacokinetics and pharmacodynamics. As with many pyrazole derivatives, it may exhibit a range of biological activities, making it of interest for further research in drug discovery and development.
Formula:C12H12FN3O2
InChI:InChI=1S/C12H12FN3O2/c1-2-18-12(17)10-7-15-16(11(10)14)9-5-3-4-8(13)6-9/h3-7H,2,14H2,1H3
InChI key:InChIKey=YSWPRCFEKILVOS-UHFFFAOYSA-N
SMILES:NC=1N(N=CC1C(OCC)=O)C2=CC(F)=CC=C2
Synonyms:
  • 1H-Pyrazole-4-carboxylic acid, 5-amino-1-(3-fluorophenyl)-, ethyl ester
  • Ethyl 5-amino-1-(3-fluorophenyl)-1H-pyrazole-4-carboxylate
  • 5-Amino-1-(3-fluorophenyl)-1H-pyrazole-4-carboxylic acid ethyl ester
  • ethyl 5-amino-1-(3-fluorophenyl)pyrazole-4-carboxylate
Found 3 products.