CAS 13892-06-3
:1,1,1-trimethyl-N-(triphenylphosphoranyl-idene)si
Description:
1,1,1-Trimethyl-N-(triphenylphosphoranyl-idene)si, identified by its CAS number 13892-06-3, is a chemical compound that features a silicon atom bonded to a triphenylphosphoranyl group and three methyl groups. This compound is characterized by its unique structure, which includes a silicon atom that is typically tetravalent, allowing it to form various coordination complexes. The presence of the triphenylphosphoranyl moiety suggests potential applications in coordination chemistry and catalysis, as phosphines are known for their ability to stabilize metal centers and facilitate various chemical reactions. The trimethyl groups contribute to the steric bulk of the molecule, potentially influencing its reactivity and solubility. Additionally, the compound may exhibit interesting electronic properties due to the interactions between the silicon and phosphorus atoms, which can affect its behavior in chemical reactions. Overall, this compound represents a fascinating area of study within organosilicon and organophosphorus chemistry, with potential implications in materials science and synthetic chemistry.
Formula:C21H24NPSi
InChI:InChI=1/C21H24NPSi/c1-24(2,3)22-23(19-13-7-4-8-14-19,20-15-9-5-10-16-20)21-17-11-6-12-18-21/h4-18H,1-3H3
SMILES:C[Si](C)(C)N=P(c1ccccc1)(c1ccccc1)c1ccccc1
Synonyms:- 1,1,1-Trimethyl-N-(triphenylphosphoranylidene)silanamine
- Triphenyl[(Trimethylsilyl)Imino]-Lambda~5~-Phosphane
- Trimethyl(triphenylphosphoranylideneamino)silane
- Triphenyl-N-(trimethylsilyl)phosphine imide
- triphenyl(trimethylsilylimino)-$l^{5}-phosphane
- Triphenyl(trimethylsilylimino)phosphorane
- N-Trimethylsilyliminotriphenylphosphorane
- N-(Trimethylsilyl)triphenylphosphine imide
- N-(Trimethylsilyl)-P,P,P-triphenylphosphine imide
- α,α,α-Trimethyl-N-(triphenylphosphoranylidene)silanamine
- Phosphine imide, P,P,P-triphenyl-N-(trimethylsilyl)-
- 1,1,1-trimethyl-N-(triphenylphosphoranyl-idene)si
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
