CAS 1389310-07-9

4-Pyrimidinamine, N-(3S)-3-pyrrolidinyl-, hydrochloride (1:2)

Description:

4-Pyrimidinamine, N-(3S)-3-pyrrolidinyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrimidine and pyrrolidine moieties, which contribute to its biological activity. This substance typically appears as a hydrochloride salt, enhancing its solubility in water and making it suitable for various pharmaceutical applications. The presence of the pyrimidinamine structure suggests potential interactions with biological targets, particularly in the realm of medicinal chemistry, where it may exhibit properties such as antimicrobial or antiviral activity. The specific stereochemistry indicated by the (3S) designation implies that the compound has a defined three-dimensional arrangement, which can significantly influence its pharmacological properties and interactions with biological systems. As with many compounds in this class, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, this compound's unique structural features and properties make it a subject of interest in drug development and research.

Formula: C₈H₁₂N₄·2ClH

InChI: InChI=1S/C8H12N4.2ClH/c1-3-9-5-7(1)12-8-2-4-10-6-11-8;;/h2,4,6-7,9H,1,3,5H2,(H,10,11,12);2*1H/t7-;;/m0../s1

InChI key: InChIKey=XSPXVKUSJFPCNR-KLXURFKVSA-N

SMILES: N(C=1C=CN=CN1)[C@H]2CCNC2.Cl

Synonyms:

• N-[(3S)-Pyrrolidin-3-yl]pyrimidin-4-amine dihydrochloride
• 4-Pyrimidinamine, N-(3S)-3-pyrrolidinyl-, hydrochloride (1:2)

N-[(3S)-Pyrrolidin-3-yl]pyrimidin-4-amine dihydrochloride

CAS: 1389310-07-9

N-[(3S)-Pyrrolidin-3-yl]pyrimidin-4-amine dihydrochloride

Purity: ≥95%

Molecular weight: 237.13g/mol

Ref: 54-OR306402

N-[(3S)-Pyrrolidin-3-yl]pyrimidin-4-amine dihydrochloride

CAS: 1389310-07-9

Formula: C₈H₁₄Cl₂N₄

Molecular weight: 237.13

Ref: 10-F091417