CAS 1389313-27-2
:2-(2,2,2-Trifluoro-1-phenylethyl)piperidine
Description:
2-(2,2,2-Trifluoro-1-phenylethyl)piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and a trifluoromethyl-substituted phenylethyl group. This compound features a piperidine moiety, a six-membered saturated nitrogen-containing ring, which contributes to its potential as a pharmacophore in medicinal chemistry. The presence of the trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, making it of interest in drug design. The trifluoromethyl group is known for its electron-withdrawing properties, which can affect the reactivity and stability of the compound. Additionally, the phenyl group provides aromatic characteristics, potentially impacting the compound's interactions with biological targets. The compound's molecular structure suggests it may exhibit interesting pharmacological properties, although specific biological activities would require empirical investigation. Overall, 2-(2,2,2-Trifluoro-1-phenylethyl)piperidine represents a class of compounds that may have applications in pharmaceuticals, particularly in the development of new therapeutic agents.
Formula:C13H16F3N
InChI:InChI=1S/C13H16F3N/c14-13(15,16)12(10-6-2-1-3-7-10)11-8-4-5-9-17-11/h1-3,6-7,11-12,17H,4-5,8-9H2
InChI key:InChIKey=DWYITFYTKHCOSX-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(C1=CC=CC=C1)C2CCCCN2
Synonyms:- 2-(2,2,2-Trifluoro-1-phenylethyl)piperidine
- Piperidine, 2-(2,2,2-trifluoro-1-phenylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
