CAS 1389313-42-1

4-Piperidinemethanamine, 1-(4-quinazolinyl)-, hydrochloride (1:2)

Description:

4-Piperidinemethanamine, 1-(4-quinazolinyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and quinazoline moieties, which contribute to its biological activity. The piperidine ring provides a basic nitrogen atom, making the compound a potential candidate for interactions with biological targets, particularly in medicinal chemistry. The quinazoline structure is known for its presence in various pharmacologically active compounds, often exhibiting properties such as antitumor and antimicrobial activities. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for pharmaceutical applications. The compound's molecular structure suggests it may engage in hydrogen bonding and other interactions, influencing its pharmacokinetics and pharmacodynamics. Its specific applications and efficacy would depend on further studies, including in vitro and in vivo evaluations. Overall, this compound represents a class of substances that may hold promise in drug development, particularly in targeting specific receptors or pathways in disease processes.

Formula: C₁₄H₁₈N₄·2ClH

InChI: InChI=1S/C14H18N4.2ClH/c15-9-11-5-7-18(8-6-11)14-12-3-1-2-4-13(12)16-10-17-14;;/h1-4,10-11H,5-9,15H2;2*1H

InChI key: InChIKey=FJZJYIIUJSZVEY-UHFFFAOYSA-N

SMILES: C(N)C1CCN(C=2C3=C(N=CN2)C=CC=C3)CC1.Cl

Synonyms:

• 4-Piperidinemethanamine, 1-(4-quinazolinyl)-, hydrochloride (1:2)

[1-(Quinazolin-4-yl)piperidin-4-yl]methanamine dihydrochloride

CAS: 1389313-42-1

[1-(Quinazolin-4-yl)piperidin-4-yl]methanamine dihydrochloride

Purity: ≥95%

Molecular weight: 315.24g/mol

Ref: 54-OR306412

[1-(Quinazolin-4-yl)piperidin-4-yl]methanamine dihydrochloride

CAS: 1389313-42-1

Molecular weight: 315.239990234375

Ref: 10-F091311