CAS 1389313-53-4

4,4-Difluoro-1-[(4-fluorophenyl)methyl]cyclohexanecarboxylic acid

Description:

4,4-Difluoro-1-[(4-fluorophenyl)methyl]cyclohexanecarboxylic acid is a synthetic organic compound characterized by its cyclohexane backbone, which is substituted with two fluorine atoms and a phenyl group. The presence of the carboxylic acid functional group imparts acidic properties to the molecule, making it capable of participating in various chemical reactions, such as esterification or amidation. The fluorine substituents enhance the compound's lipophilicity and may influence its biological activity, potentially affecting its pharmacokinetic properties. This compound is likely to exhibit moderate to high stability under standard conditions, although it may be sensitive to strong bases or nucleophiles due to the presence of the carboxylic acid. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the compound's unique fluorinated structure may contribute to its efficacy and selectivity in biological systems, making it a subject of interest in drug discovery and development.

Formula: C₁₄H₁₅F₃O₂

InChI: InChI=1S/C14H15F3O2/c15-11-3-1-10(2-4-11)9-13(12(18)19)5-7-14(16,17)8-6-13/h1-4H,5-9H2,(H,18,19)

InChI key: InChIKey=UPEDUPBRPAGIPB-UHFFFAOYSA-N

SMILES: C(C1(C(O)=O)CCC(F)(F)CC1)C2=CC=C(F)C=C2

Synonyms:

• Cyclohexanecarboxylic acid, 4,4-difluoro-1-[(4-fluorophenyl)methyl]-
• 4,4-Difluoro-1-[(4-fluorophenyl)methyl]cyclohexanecarboxylic acid

4,4-Difluoro-1-[(4-fluorophenyl)methyl]cyclohexane-1-carboxylic acid

CAS: 1389313-53-4

Versatile small molecule scaffold

Formula: C₁₄H₁₅F₃O₂

Purity: Min. 95%

Molecular weight: 272.26 g/mol

Ref: 3D-PFC31353