CAS 1389315-13-2
:Pyrimidine, 4-methyl-6-(4-piperidinyloxy)-, hydrochloride (1:1)
Description:
Pyrimidine, 4-methyl-6-(4-piperidinyloxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The presence of a methyl group at the 4-position and a piperidinyloxy group at the 6-position contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, particularly in pharmaceutical formulations. This compound may exhibit pharmacological effects due to its structural features, making it of interest in medicinal chemistry. Its CAS number, 1389315-13-2, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential uses. Safety data sheets and handling guidelines should be consulted for information on toxicity and safe handling practices, as with any chemical substance. Overall, this compound represents a specific class of pyrimidine derivatives with potential applications in drug development.
Formula:C10H15N3O·ClH
InChI:InChI=1S/C10H15N3O.ClH/c1-8-6-10(13-7-12-8)14-9-2-4-11-5-3-9;/h6-7,9,11H,2-5H2,1H3;1H
InChI key:InChIKey=CZZZGZLNZCHREQ-UHFFFAOYSA-N
SMILES:O(C=1C=C(C)N=CN1)C2CCNCC2.Cl
Synonyms:- Pyrimidine, 4-methyl-6-(4-piperidinyloxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
