CAS 138942-61-7

3-amino-1-phenyl-1H-pyrazole-4-carbonitrile

Description:

3-Amino-1-phenyl-1H-pyrazole-4-carbonitrile is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an amino group (-NH2) and a phenyl group (C6H5) attached to the pyrazole, contributing to its reactivity and potential biological activity. The presence of a carbonitrile group (-C≡N) at the 4-position enhances its chemical properties, making it a versatile intermediate in organic synthesis. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. Its unique structure allows for various applications, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals. The compound's reactivity can be influenced by the functional groups present, making it a candidate for further chemical modifications. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.

Formula: C₁₀H₈N₄

InChI: InChI=1/C10H8N4/c11-6-8-7-14(13-10(8)12)9-4-2-1-3-5-9/h1-5,7H,(H2,12,13)

SMILES: c1ccc(cc1)n1cc(C#N)c(=N)[nH]1

1H-Pyrazole-4-carbonitrile, 3-amino-1-phenyl-

CAS: 138942-61-7

Formula: C₁₀H₈N₄

Molecular weight: 184.1973

Ref: IN-DA0019W1

3-Amino-1-phenyl-1H-pyrazole-4-carbonitrile

CAS: 138942-61-7

3-Amino-1-phenyl-1H-pyrazole-4-carbonitrile

Formula: C₁₀H₈N₄

Purity: 95%

Color and Shape: off-white crystalline solid

Molecular weight: 184.20g/mol

Ref: 54-OR21176

3-Amino-1-phenyl-1H-pyrazole-4-carbonitrile

CAS: 138942-61-7

3-Amino-1-phenyl-1H-pyrazole-4-carbonitrile (APC) is an organic compound that belongs to the class of isocyanates. It is a white solid with a melting point of 103°C and can be easily synthesized by reacting 1-acetyl-2-phenylhydrazine with methyl isocyanate. This compound has been used in the synthesis of pharmaceuticals, such as antihypertensives, antihistamines, antipsychotics, and antidepressants. APC also has applications in the synthesis of polyurethanes and other compounds.

Formula: C₁₀H₈N₄

Purity: Min. 95%

Molecular weight: 184.2 g/mol

Ref: 3D-NFA94261