CAS 138965-89-6
:3-[2-(Decahydro-5,5,8a-trimethyl-2-methylene-1-naphthalenyl)ethylidene]-5-ethoxydihydro-2(3H)-furanone
Description:
3-[2-(Decahydro-5,5,8a-trimethyl-2-methylene-1-naphthalenyl)ethylidene]-5-ethoxydihydro-2(3H)-furanone, with CAS number 138965-89-6, is a synthetic organic compound characterized by its complex structure, which includes a furanone ring and a naphthalene derivative. This compound features a dihydrofuran moiety, indicating it has a five-membered ring containing oxygen, which contributes to its potential reactivity and stability. The presence of the ethoxy group suggests solubility in organic solvents, while the naphthalene component may impart aromatic properties, influencing its interactions and applications. The compound's structure indicates it may exhibit interesting biological activities, making it a candidate for research in fields such as medicinal chemistry or fragrance formulation. Its unique arrangement of functional groups could also lead to specific chemical behaviors, such as reactivity under certain conditions or interactions with biological targets. Overall, this compound exemplifies the complexity and diversity found in organic chemistry, particularly in the design of molecules with potential utility in various applications.
Formula:C22H34O3
InChI:InChI=1S/C22H34O3/c1-6-24-19-14-16(20(23)25-19)9-10-17-15(2)8-11-18-21(3,4)12-7-13-22(17,18)5/h9,17-19H,2,6-8,10-14H2,1,3-5H3
InChI key:InChIKey=HUJJMXMBEMUVOX-UHFFFAOYSA-N
SMILES:CC12C(C(C)(C)CCC1)CCC(=C)C2CC=C3C(=O)OC(OCC)C3
Synonyms:- 3-[2-(Decahydro-5,5,8a-trimethyl-2-methylene-1-naphthalenyl)ethylidene]-5-ethoxydihydro-2(3H)-furanone
- Coronarin D ethyl ether
- Ethoxycoronarin D
- 2(3H)-Furanone, 3-[2-(decahydro-5,5,8a-trimethyl-2-methylene-1-naphthalenyl)ethylidene]-5-ethoxydihydro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Coronarin D ethyl ether
CAS:<p>Coronarin D blocks NF-KB, reducing inflammation, invasion, and bone loss, promoting cell death, and has strong anti-Candida effects in lab tests.</p>Formula:C22H34O3Purity:98%Color and Shape:SolidMolecular weight:346.5Coronarin D ethyl ether
CAS:Formula:C22H34O3Purity:95%~99%Color and Shape:PowderMolecular weight:346.511Coronarin D ethyl ether
CAS:<p>Coronarin D ethyl ether is a diterpenoid compound, which is derived from the plant Hedychium coronarium, also known as white ginger lily. This compound belongs to a class of naturally occurring chemicals with complex polycyclic structures. The source of Coronarin D ethyl ether is the rhizome of Hedychium coronarium, which is part of the Zingiberaceae family. These plants are often studied for their bioactive properties and potential therapeutic applications.</p>Formula:C22H34O3Purity:Min. 95%Molecular weight:346.5 g/mol


