CAS 139-27-5
:1-[3-(Benzoyloxy)phenyl]-2-bromoethanone
Description:
1-[3-(Benzoyloxy)phenyl]-2-bromoethanone, with the CAS number 139-27-5, is an organic compound characterized by its complex structure that includes a bromine atom, a ketone functional group, and a benzoyloxy substituent. This compound typically appears as a solid or crystalline substance and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water due to its hydrophobic aromatic components. The presence of the bromine atom contributes to its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. The benzoyloxy group enhances the compound's stability and can influence its biological activity, making it of interest in medicinal chemistry. Additionally, this compound may exhibit specific optical properties, which can be studied using spectroscopic techniques. Safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled, and appropriate personal protective equipment should be used.
Formula:C15H11BrO3
InChI:InChI=1S/C15H11BrO3/c16-10-14(17)12-7-4-8-13(9-12)19-15(18)11-5-2-1-3-6-11/h1-9H,10H2
InChI key:InChIKey=NBQCBERBYQMIFD-UHFFFAOYSA-N
SMILES:O(C(=O)C1=CC=CC=C1)C2=CC(C(CBr)=O)=CC=C2
Synonyms:- (3Alpha,5Beta)-3-Hydroxyandrostane-11,17-Dione
- 1-[3-(Benzoyloxy)phenyl]-2-bromoethanone
- 2-Bromo-3′-hydroxyacetophenone benzoate
- 3-(Bromoacetyl)Phenyl Benzoate
- 3′-(Benzoyloxy)-2-bromoacetophenone
- Acetophenone, 2-bromo-3′-hydroxy-, benzoate
- Ethanone, 1-[3-(benzoyloxy)phenyl]-2-bromo-
- NSC 72995
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
