CAS 139-28-6
:M-(BENZOYLOXY)ACETOPHENONE
Description:
M-(Benzyloxy)acetophenone, with the CAS number 139-28-6, is an organic compound characterized by its structure, which includes a benzoyloxy group attached to an acetophenone moiety. This compound typically appears as a white to off-white crystalline solid. It is known for its applications in organic synthesis, particularly in the field of pharmaceuticals and fine chemicals. The presence of the benzoyloxy group enhances its reactivity, making it useful in various chemical reactions, including acylation and coupling reactions. M-(Benzyloxy)acetophenone exhibits moderate solubility in organic solvents such as ethanol and acetone, while being less soluble in water due to its hydrophobic nature. Its melting point and boiling point can vary based on purity and specific conditions. As with many organic compounds, it should be handled with care, following appropriate safety protocols to avoid exposure or adverse reactions. Overall, M-(benzyloxy)acetophenone is a valuable compound in synthetic organic chemistry, contributing to the development of more complex molecules.
Formula:C15H12O3
InChI:InChI=1S/C15H12O3/c1-11(16)13-8-5-9-14(10-13)18-15(17)12-6-3-2-4-7-12/h2-10H,1H3
InChI key:InChIKey=CCDOBBGYSDWGKY-UHFFFAOYSA-N
SMILES:O(C(=O)C1=CC=CC=C1)C2=CC(C(C)=O)=CC=C2
Synonyms:- 1-[3-(Benzoyloxy)phenyl]ethanone
- 3'-Hydroxyacetophenone, benzoate
- 3-Acetylphenyl benzoate
- 3-Acetylphenylbenzoate
- Acetophenone, 3'-hydroxy-, benzoate
- Ethanone, 1-[3- (benzoyloxy)phenyl]-
- NSC 103148
- m-Acetylphenyl benzoate
- m-(Benzoyloxy)acetophenone
- CCDOBBGYSDWGKY-UHFFFAOYSA-N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-Benzoyloxyacetophenone
CAS:Controlled ProductFormula:C15H12O3Color and Shape:NeatMolecular weight:240.25

