CAS 139022-25-6

IMIDAZO[1,2-A]PYRIDINE-6-CARBOXYLIC ACID

Description:

Imidazo[1,2-a]pyridine-6-carboxylic acid is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group, enhancing its acidity and making it soluble in polar solvents. The presence of nitrogen atoms in the ring structure can influence its reactivity and potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure allows for various substitution patterns, which can lead to diverse derivatives with varying biological activities. The compound is often studied for its potential applications in pharmaceuticals, particularly in the development of drugs targeting specific receptors or enzymes. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, imidazo[1,2-a]pyridine-6-carboxylic acid represents a significant class of compounds in organic synthesis and drug discovery, with ongoing research exploring its full potential in various applications.

Formula: C₈H₆N₂O₂

InChI: InChI=1/C8H6N2O2/c11-8(12)6-1-2-7-9-3-4-10(7)5-6/h1-5H,(H,11,12)

SMILES: c1cc2nccn2cc1C(=O)O

Synonyms:

• H-imidazo[1,2-a]pyridine-6-carboxylic acid

IMIDAZO[1,2-A]PYRIDINE-6-CARBOXYLIC ACID

CAS: 139022-25-6

Formula: C₈H₆N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 162.1454

Ref: IN-DA001A1O

Imidazo[1,2-a]pyridine-6-carboxylic acid

CAS: 139022-25-6

Imidazo[1,2-a]pyridine-6-carboxylic acid

Purity: ≥95%

Color and Shape: White Solid

Molecular weight: 162.14544g/mol

Ref: 54-OR6355

Imidazo[1,2-a]pyridine-6-carboxylic acid

CAS: 139022-25-6

Formula: C₈H₆N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 162.148

Ref: 10-F066553

Imidazo[1,2-a]pyridine-6-carboxylic acid

Controlled Product

CAS: 139022-25-6

Applications Imidazo[1,2-a]pyridine-6-carboxylic acid

Formula: C₈H₆N₂O₂

Color and Shape: Neat

Molecular weight: 162.145

Ref: TR-I387580