CAS 13905-48-1

1-Bromo-3-methylcyclohexane

Description:

1-Bromo-3-methylcyclohexane is an organic compound characterized by a cyclohexane ring with a bromine atom and a methyl group attached to it. The presence of the bromine atom introduces significant reactivity, making it a useful intermediate in various organic synthesis reactions, particularly in nucleophilic substitution and elimination reactions. The methyl group contributes to the compound's hydrophobic nature, influencing its solubility in organic solvents while rendering it less soluble in water. This compound typically appears as a colorless to pale yellow liquid and has a distinct odor. Its boiling point and density are influenced by the molecular structure and the presence of the bromine substituent. Additionally, 1-bromo-3-methylcyclohexane can undergo various chemical reactions, including radical reactions and electrophilic additions, making it valuable in synthetic organic chemistry. Safety precautions should be observed when handling this compound, as it may pose health risks due to its halogenated nature. Overall, its unique structural features and reactivity profile make it an interesting subject of study in organic chemistry.

Formula: C₇H₁₃Br

InChI: InChI=1S/C7H13Br/c1-6-3-2-4-7(8)5-6/h6-7H,2-5H2,1H3

InChI key: InChIKey=CAKVGNXMAZLDPV-UHFFFAOYSA-N

SMILES: BrC1CC(C)CCC1

Synonyms:

• NSC 9390
• 3-Methylcyclohexyl bromide
• 1-Bromo-3-methylcyclohexane
• Cyclohexane, 1-bromo-3-methyl-

1-Bromo-3-methylcyclohexane

CAS: 13905-48-1

Formula: C₇H₁₃Br

Molecular weight: 177.0821

Ref: IN-DA001A33

1-Bromo-3-methylcyclohexane

CAS: 13905-48-1

1-Bromo-3-methylcyclohexane is an organic compound that is used as a catalyst in the petroleum industry. It is activated by heating, which converts it to its active form. 1-Bromo-3-methylcyclohexane is also a precursor for the production of biofuels and other chemicals.
1-Bromo-3-methylcyclohexane can be activated by heating it under nitrogen gas, which creates a more stable product. This process can be used to create pyrolysis oil, which can be refined into biofuel or other chemicals.

Formula: C₇H₁₃Br

Purity: Min. 95%

Molecular weight: 177.08 g/mol

Ref: 3D-NAA90548