CymitQuimica logo

CAS 139059-00-0

:

ethyl (4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydrooxazole-4-carboxylate

Description:
Ethyl (4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydrooxazole-4-carboxylate, identified by its CAS number 139059-00-0, is a chemical compound characterized by its complex structure, which includes an oxazole ring and various functional groups. The presence of the ethyl ester indicates that it has a carboxylic acid moiety, contributing to its potential reactivity and solubility properties. The methylsulfonyl group enhances its polarity and may influence its biological activity, making it of interest in medicinal chemistry. The stereochemistry denoted by (4R,5R) suggests specific spatial arrangements of atoms, which can significantly affect the compound's interactions with biological targets. This compound may exhibit properties such as moderate to high solubility in organic solvents, and its structural features could be relevant in the development of pharmaceuticals or agrochemicals. Overall, its unique combination of functional groups and stereochemistry positions it as a potentially valuable compound in various chemical applications.
Formula:C19H19NO5S
InChI:InChI=1/C19H19NO5S/c1-3-24-19(21)16-17(13-9-11-15(12-10-13)26(2,22)23)25-18(20-16)14-7-5-4-6-8-14/h4-12,16-17H,3H2,1-2H3/t16-,17-/m1/s1
SMILES:CCOC(=O)[C@H]1[C@@H](c2ccc(cc2)S(=O)(=O)C)OC(=N1)c1ccccc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.