CAS 13906-90-6
:2-(Phenylmethyl)aziridine
Description:
2-(Phenylmethyl)aziridine, with the CAS number 13906-90-6, is a cyclic organic compound characterized by a three-membered aziridine ring substituted with a phenylmethyl group. This compound features a nitrogen atom within the ring, contributing to its basicity and potential reactivity. The presence of the phenylmethyl group enhances its lipophilicity, which can influence its solubility in organic solvents. 2-(Phenylmethyl)aziridine is of interest in organic synthesis and medicinal chemistry due to its potential as a building block for more complex molecules. Its structure allows for various chemical transformations, including ring-opening reactions, which can lead to the formation of larger, more functionalized compounds. Additionally, the aziridine ring can exhibit strain, making it reactive under certain conditions, which is valuable in synthetic applications. Overall, this compound serves as a versatile intermediate in the development of pharmaceuticals and other organic materials.
Formula:C9H11N
InChI:InChI=1S/C9H11N/c1-2-4-8(5-3-1)6-9-7-10-9/h1-5,9-10H,6-7H2
InChI key:InChIKey=LKQAJXTWYDNYHK-UHFFFAOYSA-N
SMILES:C(C1=CC=CC=C1)C2CN2
Synonyms:- (2R)-2-Benzylaziridin
- (2R)-2-Benzylaziridine
- 2-(Phenylmethyl)aziridine
- Aziridine, 2-(phenylmethyl)-
- Aziridine, 2-(phenylmethyl)-, (2R)-
- Aziridine, 2-benzyl-
- 2-Benzylaziridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Benzylaziridine
CAS:Controlled Product2-Benzylaziridine is an organic compound that can be synthesized from 2-benzyloxirane and ammonia. It is used as a chromatographic stationary phase, a synthetic intermediate, and a starting material for the synthesis of other aziridines. The reaction rate of this compound depends on the energy of the reaction. Low energy reactions are generally faster than high energy reactions. In addition, ring-opening reactions are faster than aziridine synthesis because they require less activation energy. 2-Benzylaziridine can be produced in two different isomeric forms: cis and trans. This compound has been shown to have impurities such as isosafrole and aziridine which may be difficult to remove by distillation or recrystallization alone. 2-Benzylaziridine has been shown to have low toxicity in animal studies.END>>Formula:C9H11NPurity:Min. 95%Molecular weight:133.19 g/mol

