CAS 139062-99-0
:N-Ethyl-N-4-piperidinylacetamide
Description:
N-Ethyl-N-4-piperidinylacetamide, identified by its CAS number 139062-99-0, is a chemical compound that belongs to the class of piperidine derivatives. It features a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and is substituted with an ethyl group and an acetamide moiety. This compound is typically characterized by its moderate polarity, which influences its solubility in various organic solvents. The presence of the piperidine ring contributes to its potential biological activity, making it of interest in medicinal chemistry. N-Ethyl-N-4-piperidinylacetamide may exhibit properties such as analgesic or anti-inflammatory effects, although specific biological activities can vary based on structural modifications and the context of use. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Safety and handling precautions are essential, as with any chemical substance, to mitigate risks associated with exposure.
Formula:C9H18N2O
InChI:InChI=1S/C9H18N2O/c1-3-11(8(2)12)9-4-6-10-7-5-9/h9-10H,3-7H2,1-2H3
InChI key:InChIKey=OCERHFVIXWVCFP-UHFFFAOYSA-N
SMILES:N(C(C)=O)(CC)C1CCNCC1
Synonyms:- N-Ethyl-N-4-piperidinylacetamide
- Acetamide, N-ethyl-N-4-piperidinyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
