CAS 1390654-14-4

1H-Imidazole-1-ethanamine, 4,5-dimethyl-, hydrochloride (1:2)

Description:

1H-Imidazole-1-ethanamine, 4,5-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features an ethylamine side chain and two methyl groups at the 4 and 5 positions of the imidazole ring, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals and biochemistry. The presence of the imidazole moiety suggests potential biological activity, as imidazole derivatives are often involved in enzyme catalysis and serve as ligands in coordination chemistry. The compound's molecular structure may influence its interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the hydrochloride form can affect the stability and bioavailability of the compound, which is crucial for its application in drug formulation and development.

Formula: C₇H₁₃N₃·2ClH

InChI: InChI=1S/C7H13N3.2ClH/c1-6-7(2)10(4-3-8)5-9-6;;/h5H,3-4,8H2,1-2H3;2*1H

InChI key: InChIKey=FFFLQSZQZXGUAY-UHFFFAOYSA-N

SMILES: C(CN)N1C(C)=C(C)N=C1.Cl

Synonyms:

• 1H-Imidazole-1-ethanamine, 4,5-dimethyl-, hydrochloride (1:2)

2-(4,5-Dimethyl-1H-imidazol-1-yl)ethan-1-amine dihydrochloride

CAS: 1390654-14-4

Versatile small molecule scaffold

Formula: C₇H₁₅Cl₂N₃

Purity: Min. 95%

Molecular weight: 212.12 g/mol

Ref: 3D-QFC65414