CAS 1390654-21-3

3,9-Diazaspiro[5.6]dodecan-10-one, 9-methyl-, hydrochloride (1:2)

Description:

3,9-Diazaspiro[5.6]dodecan-10-one, 9-methyl-, hydrochloride (1:2) is a chemical compound characterized by its unique spirocyclic structure, which consists of a dodecane backbone with two nitrogen atoms incorporated into the ring system. This compound features a ketone functional group and a methyl substituent at the 9-position, contributing to its chemical reactivity and potential biological activity. The hydrochloride form indicates that it is a salt, which enhances its solubility in water and may influence its pharmacokinetic properties. The presence of nitrogen atoms in the structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its specific stereochemistry and spatial arrangement can significantly affect its biological activity and interactions. As with many nitrogen-containing compounds, it may exhibit properties such as basicity and the ability to form hydrogen bonds, which are crucial for its behavior in biological systems. Further studies would be necessary to elucidate its specific applications and effects in various chemical and biological contexts.

Formula: C₁₁H₂₀N₂O·2ClH

InChI: InChI=1S/C11H20N2O.2ClH/c1-13-9-6-11(3-2-10(13)14)4-7-12-8-5-11;;/h12H,2-9H2,1H3;2*1H

InChI key: InChIKey=JNGFQPLNWXXUTN-UHFFFAOYSA-N

SMILES: O=C1CCC2(CCN1C)CCNCC2.Cl

Synonyms:

• 3,9-Diazaspiro[5.6]dodecan-10-one, 9-methyl-, hydrochloride (1:2)

9-methyl-3,9-diazaspiro[5.6]dodecan-10-one dihydrochloride

CAS: 1390654-21-3

Formula: C₁₁H₂₂Cl₂N₂O

Purity: 95.0%

Molecular weight: 269.21

Ref: 10-F360356